gregorysamantharodri gregorysamantharodri

07-02-2024
Mathematics

contestada

Gus needs to earn $300 to Buy the bicycle.find at least three posible ways Gus could earn enough money from mowing lanws and washing cars

Respuesta :

saddlerblake saddlerblake

07-02-2024

How much is he going to make?

Answer Link

Otras preguntas

In what form did the Sanskrit language originate?

The term "automation" refers to what?

why did the colonist objected ot the proclamation of 1763

What is 11.42424242 as a fraction

What is the simplified form of the expression? (3x 7/2) 6 (x^2)6

Which type of organizational structure would best meet the writer’s needs?A food critic needs to write a review of two icy desserts. While both were light and

PLEASE HELP ME! WILL REWARD BRAINILIEST! If a bacterium did not regulate gene expression, what would occur? A. wasted energy B. removed energy C. conserved ener

Fill in the coefficients that will balance the following reaction: a0Ca + a1CO2 + a2O2 → a3CaCO3

Read the sentence. Each of the singers in the boys’ choir must practice _____ part. Which personal pronoun correctly completes the sentence? A. its B. his

fill in the blank __ pi/3 sinpi/6=1/2(sinpi/2-sinpi/6)