willowcollins9808 willowcollins9808
  • 07-09-2019
  • History
contestada

Which central american country does not have spanish as its official language

Respuesta :

smna7
smna7 smna7
  • 07-09-2019
Belize
Spanish in Belize
Formerly known as British Honduras, Belize is the only country in Central America that doesn't have Spanish as its national language. The official language is English, but the most widely spoken language is Kriol, an English-based creole that includes elements of indigenous languages
Answer Link

Otras preguntas

What is the total capacitance in units of mF, of the two capacitors connected in series, as shown in the diagram, when C1 = 45 mF and C2 = 26 mF?
Find the axis of symmetry f(x)=3(x+4)^2+1
which equation represents a proportional relastionship that has a constant of proportionality equal to 4/5y=x+ 4/5 y= 4/5xxy=4/5x+y=4/5​
There are different types of characters in a story .The protagonist is another name for the central character in a story.The antagonist is the character that is
Are left handed people better
What does REFUTATRONS mean
Briefly explain how the advertisement reflects changes in American society in the 1920s.
what is the enthalpy of 2NO2(g) yields N2(g) + 2O2 (g)
simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)​
Hi! I’m currently taking Spanish 1. And I was wondering if someone could help me with #1-7. Thank you so very much!